C9H9Cl3O2S — CID 170821094
3-sulfanyl-1-(2,3,6-trichlorophenyl)propane-1,2-diol (PubChem CID 170821094) has the molecular formula C9H9Cl3O2S and a molecular weight of 287.60 g/mol. Its IUPAC name is 3-sulfanyl-1-(2,3,6-trichlorophenyl)propane-1,2-diol.
| Compound Name | 3-sulfanyl-1-(2,3,6-trichlorophenyl)propane-1,2-diol |
|---|---|
| PubChem CID | 170821094 |
| Molecular Formula | C9H9Cl3O2S |
| Molecular Weight | 287.60 g/mol |
| Exact Mass | 285.94 |
| IUPAC Name | 3-sulfanyl-1-(2,3,6-trichlorophenyl)propane-1,2-diol |
| SMILES | OC(CS)C(O)c1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C9H9Cl3O2S/c10-4-1-2-5(11)8(12)7(4)9(14)6(13)3-15/h1-2,6,9,13-15H,3H2 |
| InChIKey | KSYVVDQMLJXIHG-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.60 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|