C20H22Cl4O4 — CID 126575211
(1S,2S)-4-[2,4-dichloro-3-[(1R,2R)-1,2-dihydroxybutyl]phenyl]-1-(2,6-dichlorophenyl)butane-1,2-diol (PubChem CID 126575211) has the molecular formula C20H22Cl4O4 and a molecular weight of 468.20 g/mol. Its IUPAC name is (1S,2S)-4-[2,4-dichloro-3-[(1R,2R)-1,2-dihydroxybutyl]phenyl]-1-(2,6-dichlorophenyl)butane-1,2-diol.
| Compound Name | (1S,2S)-4-[2,4-dichloro-3-[(1R,2R)-1,2-dihydroxybutyl]phenyl]-1-(2,6-dichlorophenyl)butane-1,2-diol |
|---|---|
| PubChem CID | 126575211 |
| Molecular Formula | C20H22Cl4O4 |
| Molecular Weight | 468.20 g/mol |
| Exact Mass | 466.03 |
| IUPAC Name | (1S,2S)-4-[2,4-dichloro-3-[(1R,2R)-1,2-dihydroxybutyl]phenyl]-1-(2,6-dichlorophenyl)butane-1,2-diol |
| SMILES | CC[C@@H](O)[C@H](O)c1c(Cl)ccc(CC[C@H](O)[C@@H](O)c2c(Cl)cccc2Cl)c1Cl |
| InChI | InChI=1S/C20H22Cl4O4/c1-2-14(25)19(27)17-13(23)8-6-10(18(17)24)7-9-15(26)20(28)16-11(21)4-3-5-12(16)22/h3-6,8,14-15,19-20,25-28H,2,7,9H2,1H3/t14-,15+,19+,20-/m1/s1 |
| InChIKey | GLZRAJCJUIJFFP-VVVONTASSA-N |
| XLogP | 5.13 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.20 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |