C11H14Cl2O2 — CID 103454648
1-(2,6-dichlorophenyl)pentane-2,3-diol (PubChem CID 103454648) has the molecular formula C11H14Cl2O2 and a molecular weight of 249.14 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)pentane-2,3-diol.
| Compound Name | 1-(2,6-dichlorophenyl)pentane-2,3-diol |
|---|---|
| PubChem CID | 103454648 |
| Molecular Formula | C11H14Cl2O2 |
| Molecular Weight | 249.14 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 1-(2,6-dichlorophenyl)pentane-2,3-diol |
| SMILES | CCC(O)C(O)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C11H14Cl2O2/c1-2-10(14)11(15)6-7-8(12)4-3-5-9(7)13/h3-5,10-11,14-15H,2,6H2,1H3 |
| InChIKey | WJOJGPIRQPQTAR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.14 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |