C12H14Cl2O2 — CID 103456938
1-cyclopropyl-3-(2,6-dichlorophenyl)propane-1,2-diol (PubChem CID 103456938) has the molecular formula C12H14Cl2O2 and a molecular weight of 261.15 g/mol. Its IUPAC name is 1-cyclopropyl-3-(2,6-dichlorophenyl)propane-1,2-diol.
| Compound Name | 1-cyclopropyl-3-(2,6-dichlorophenyl)propane-1,2-diol |
|---|---|
| PubChem CID | 103456938 |
| Molecular Formula | C12H14Cl2O2 |
| Molecular Weight | 261.15 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 1-cyclopropyl-3-(2,6-dichlorophenyl)propane-1,2-diol |
| SMILES | OC(Cc1c(Cl)cccc1Cl)C(O)C1CC1 |
| InChI | InChI=1S/C12H14Cl2O2/c13-9-2-1-3-10(14)8(9)6-11(15)12(16)7-4-5-7/h1-3,7,11-12,15-16H,4-6H2 |
| InChIKey | PRIKBATWSGQIRT-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.15 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |