C12H14Cl2O2 — CID 65331137
2-(2,6-dichlorophenyl)-1-(oxolan-2-yl)ethanol (PubChem CID 65331137) has the molecular formula C12H14Cl2O2 and a molecular weight of 261.15 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)-1-(oxolan-2-yl)ethanol.
| Compound Name | 2-(2,6-dichlorophenyl)-1-(oxolan-2-yl)ethanol |
|---|---|
| PubChem CID | 65331137 |
| Molecular Formula | C12H14Cl2O2 |
| Molecular Weight | 261.15 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 2-(2,6-dichlorophenyl)-1-(oxolan-2-yl)ethanol |
| SMILES | OC(Cc1c(Cl)cccc1Cl)C1CCCO1 |
| InChI | InChI=1S/C12H14Cl2O2/c13-9-3-1-4-10(14)8(9)7-11(15)12-5-2-6-16-12/h1,3-4,11-12,15H,2,5-7H2 |
| InChIKey | DFDRXVISKWWGCE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.15 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |