C12H14ClFO2S — CID 79963503
2-(2-chloro-6-fluorophenyl)-1-(1,4-oxathian-2-yl)ethanol (PubChem CID 79963503) has the molecular formula C12H14ClFO2S and a molecular weight of 276.76 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-1-(1,4-oxathian-2-yl)ethanol.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-1-(1,4-oxathian-2-yl)ethanol |
|---|---|
| PubChem CID | 79963503 |
| Molecular Formula | C12H14ClFO2S |
| Molecular Weight | 276.76 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-1-(1,4-oxathian-2-yl)ethanol |
| SMILES | OC(Cc1c(F)cccc1Cl)C1CSCCO1 |
| InChI | InChI=1S/C12H14ClFO2S/c13-9-2-1-3-10(14)8(9)6-11(15)12-7-17-5-4-16-12/h1-3,11-12,15H,4-7H2 |
| InChIKey | PILMRNRRSWETCS-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.76 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |