C12H15BrO2S — CID 79963285
2-(3-bromophenyl)-1-(1,4-oxathian-2-yl)ethanol (PubChem CID 79963285) has the molecular formula C12H15BrO2S and a molecular weight of 303.22 g/mol. Its IUPAC name is 2-(3-bromophenyl)-1-(1,4-oxathian-2-yl)ethanol.
| Compound Name | 2-(3-bromophenyl)-1-(1,4-oxathian-2-yl)ethanol |
|---|---|
| PubChem CID | 79963285 |
| Molecular Formula | C12H15BrO2S |
| Molecular Weight | 303.22 g/mol |
| Exact Mass | 302.00 |
| IUPAC Name | 2-(3-bromophenyl)-1-(1,4-oxathian-2-yl)ethanol |
| SMILES | OC(Cc1cccc(Br)c1)C1CSCCO1 |
| InChI | InChI=1S/C12H15BrO2S/c13-10-3-1-2-9(6-10)7-11(14)12-8-16-5-4-15-12/h1-3,6,11-12,14H,4-5,7-8H2 |
| InChIKey | SNQAHSVGDLBDLZ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.22 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |