C9H13NO2S2 — CID 164654930
1-(1,4-oxathian-2-yl)-2-(1,2-thiazol-5-yl)ethanol (PubChem CID 164654930) has the molecular formula C9H13NO2S2 and a molecular weight of 231.34 g/mol. Its IUPAC name is 1-(1,4-oxathian-2-yl)-2-(1,2-thiazol-5-yl)ethanol.
| Compound Name | 1-(1,4-oxathian-2-yl)-2-(1,2-thiazol-5-yl)ethanol |
|---|---|
| PubChem CID | 164654930 |
| Molecular Formula | C9H13NO2S2 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.04 |
| IUPAC Name | 1-(1,4-oxathian-2-yl)-2-(1,2-thiazol-5-yl)ethanol |
| SMILES | OC(Cc1ccns1)C1CSCCO1 |
| InChI | InChI=1S/C9H13NO2S2/c11-8(5-7-1-2-10-14-7)9-6-13-4-3-12-9/h1-2,8-9,11H,3-6H2 |
| InChIKey | KOUUXNVKMRFXGN-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |