C9H14N2O2S — CID 79963194
(1-methylimidazol-2-yl)-(1,4-oxathian-2-yl)methanol (PubChem CID 79963194) has the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. Its IUPAC name is (1-methylimidazol-2-yl)-(1,4-oxathian-2-yl)methanol.
| Compound Name | (1-methylimidazol-2-yl)-(1,4-oxathian-2-yl)methanol |
|---|---|
| PubChem CID | 79963194 |
| Molecular Formula | C9H14N2O2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | (1-methylimidazol-2-yl)-(1,4-oxathian-2-yl)methanol |
| SMILES | Cn1ccnc1C(O)C1CSCCO1 |
| InChI | InChI=1S/C9H14N2O2S/c1-11-3-2-10-9(11)8(12)7-6-14-5-4-13-7/h2-3,7-8,12H,4-6H2,1H3 |
| InChIKey | KOQVHDZKYRZPHJ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |