C12H22N4OS — CID 105249781
[1-(1,4-oxathian-2-yl)-2-(1-propylimidazol-2-yl)ethyl]hydrazine (PubChem CID 105249781) has the molecular formula C12H22N4OS and a molecular weight of 270.40 g/mol. Its IUPAC name is [1-(1,4-oxathian-2-yl)-2-(1-propylimidazol-2-yl)ethyl]hydrazine.
| Compound Name | [1-(1,4-oxathian-2-yl)-2-(1-propylimidazol-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105249781 |
| Molecular Formula | C12H22N4OS |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | [1-(1,4-oxathian-2-yl)-2-(1-propylimidazol-2-yl)ethyl]hydrazine |
| SMILES | CCCn1ccnc1CC(NN)C1CSCCO1 |
| InChI | InChI=1S/C12H22N4OS/c1-2-4-16-5-3-14-12(16)8-10(15-13)11-9-18-7-6-17-11/h3,5,10-11,15H,2,4,6-9,13H2,1H3 |
| InChIKey | NSVAICHHWVHXCV-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|