C16H22N4O — CID 105262793
[1-(2,3-dihydro-1-benzofuran-3-yl)-2-(1-propylimidazol-2-yl)ethyl]hydrazine (PubChem CID 105262793) has the molecular formula C16H22N4O and a molecular weight of 286.38 g/mol. Its IUPAC name is [1-(2,3-dihydro-1-benzofuran-3-yl)-2-(1-propylimidazol-2-yl)ethyl]hydrazine.
| Compound Name | [1-(2,3-dihydro-1-benzofuran-3-yl)-2-(1-propylimidazol-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105262793 |
| Molecular Formula | C16H22N4O |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | [1-(2,3-dihydro-1-benzofuran-3-yl)-2-(1-propylimidazol-2-yl)ethyl]hydrazine |
| SMILES | CCCn1ccnc1CC(NN)C1COc2ccccc21 |
| InChI | InChI=1S/C16H22N4O/c1-2-8-20-9-7-18-16(20)10-14(19-17)13-11-21-15-6-4-3-5-12(13)15/h3-7,9,13-14,19H,2,8,10-11,17H2,1H3 |
| InChIKey | QDLIKKMHEMLYIZ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|