C16H30N4S — CID 106445389
N-[1-(4-methylthiomorpholin-3-yl)-2-(1-propylimidazol-2-yl)ethyl]propan-1-amine (PubChem CID 106445389) has the molecular formula C16H30N4S and a molecular weight of 310.51 g/mol. Its IUPAC name is N-[1-(4-methylthiomorpholin-3-yl)-2-(1-propylimidazol-2-yl)ethyl]propan-1-amine.
| Compound Name | N-[1-(4-methylthiomorpholin-3-yl)-2-(1-propylimidazol-2-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 106445389 |
| Molecular Formula | C16H30N4S |
| Molecular Weight | 310.51 g/mol |
| Exact Mass | 310.22 |
| IUPAC Name | N-[1-(4-methylthiomorpholin-3-yl)-2-(1-propylimidazol-2-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1nccn1CCC)C1CSCCN1C |
| InChI | InChI=1S/C16H30N4S/c1-4-6-17-14(15-13-21-11-10-19(15)3)12-16-18-7-9-20(16)8-5-2/h7,9,14-15,17H,4-6,8,10-13H2,1-3H3 |
| InChIKey | PBKRABHEPZUAAZ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.51 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |