C14H23ClN2S2 — CID 106445375
N-[2-(5-chlorothiophen-2-yl)-1-(4-methylthiomorpholin-3-yl)ethyl]propan-1-amine (PubChem CID 106445375) has the molecular formula C14H23ClN2S2 and a molecular weight of 318.94 g/mol. Its IUPAC name is N-[2-(5-chlorothiophen-2-yl)-1-(4-methylthiomorpholin-3-yl)ethyl]propan-1-amine.
| Compound Name | N-[2-(5-chlorothiophen-2-yl)-1-(4-methylthiomorpholin-3-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 106445375 |
| Molecular Formula | C14H23ClN2S2 |
| Molecular Weight | 318.94 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | N-[2-(5-chlorothiophen-2-yl)-1-(4-methylthiomorpholin-3-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1ccc(Cl)s1)C1CSCCN1C |
| InChI | InChI=1S/C14H23ClN2S2/c1-3-6-16-12(9-11-4-5-14(15)19-11)13-10-18-8-7-17(13)2/h4-5,12-13,16H,3,6-10H2,1-2H3 |
| InChIKey | SSYQAGHEMPMETL-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.94 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |