C10H16N2OS2 — CID 105249760
[1-(1,4-oxathian-2-yl)-2-thiophen-2-ylethyl]hydrazine (PubChem CID 105249760) has the molecular formula C10H16N2OS2 and a molecular weight of 244.38 g/mol. Its IUPAC name is [1-(1,4-oxathian-2-yl)-2-thiophen-2-ylethyl]hydrazine.
| Compound Name | [1-(1,4-oxathian-2-yl)-2-thiophen-2-ylethyl]hydrazine |
|---|---|
| PubChem CID | 105249760 |
| Molecular Formula | C10H16N2OS2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | [1-(1,4-oxathian-2-yl)-2-thiophen-2-ylethyl]hydrazine |
| SMILES | NNC(Cc1cccs1)C1CSCCO1 |
| InChI | InChI=1S/C10H16N2OS2/c11-12-9(6-8-2-1-4-15-8)10-7-14-5-3-13-10/h1-2,4,9-10,12H,3,5-7,11H2 |
| InChIKey | YDICTACTSQTGGV-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|