C12H16ClFN2OS — CID 102623389
[2-(2-chloro-5-fluorophenyl)-1-(1,4-oxathian-2-yl)ethyl]hydrazine (PubChem CID 102623389) has the molecular formula C12H16ClFN2OS and a molecular weight of 290.79 g/mol. Its IUPAC name is [2-(2-chloro-5-fluorophenyl)-1-(1,4-oxathian-2-yl)ethyl]hydrazine.
| Compound Name | [2-(2-chloro-5-fluorophenyl)-1-(1,4-oxathian-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 102623389 |
| Molecular Formula | C12H16ClFN2OS |
| Molecular Weight | 290.79 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | [2-(2-chloro-5-fluorophenyl)-1-(1,4-oxathian-2-yl)ethyl]hydrazine |
| SMILES | NNC(Cc1cc(F)ccc1Cl)C1CSCCO1 |
| InChI | InChI=1S/C12H16ClFN2OS/c13-10-2-1-9(14)5-8(10)6-11(16-15)12-7-18-4-3-17-12/h1-2,5,11-12,16H,3-4,6-7,15H2 |
| InChIKey | MRBQSWYMZHQRGH-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.79 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|