C13H19ClFN3O — CID 102623373
[2-(2-chloro-5-fluorophenyl)-1-(4-methylmorpholin-2-yl)ethyl]hydrazine (PubChem CID 102623373) has the molecular formula C13H19ClFN3O and a molecular weight of 287.77 g/mol. Its IUPAC name is [2-(2-chloro-5-fluorophenyl)-1-(4-methylmorpholin-2-yl)ethyl]hydrazine.
| Compound Name | [2-(2-chloro-5-fluorophenyl)-1-(4-methylmorpholin-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 102623373 |
| Molecular Formula | C13H19ClFN3O |
| Molecular Weight | 287.77 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | [2-(2-chloro-5-fluorophenyl)-1-(4-methylmorpholin-2-yl)ethyl]hydrazine |
| SMILES | CN1CCOC(C(Cc2cc(F)ccc2Cl)NN)C1 |
| InChI | InChI=1S/C13H19ClFN3O/c1-18-4-5-19-13(8-18)12(17-16)7-9-6-10(15)2-3-11(9)14/h2-3,6,12-13,17H,4-5,7-8,16H2,1H3 |
| InChIKey | NVKMKFDSGHVQIK-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.77 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|