C10H18N4OS — CID 105244511
[1-(4-methylmorpholin-2-yl)-2-(1,3-thiazol-2-yl)ethyl]hydrazine (PubChem CID 105244511) has the molecular formula C10H18N4OS and a molecular weight of 242.35 g/mol. Its IUPAC name is [1-(4-methylmorpholin-2-yl)-2-(1,3-thiazol-2-yl)ethyl]hydrazine.
| Compound Name | [1-(4-methylmorpholin-2-yl)-2-(1,3-thiazol-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105244511 |
| Molecular Formula | C10H18N4OS |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | [1-(4-methylmorpholin-2-yl)-2-(1,3-thiazol-2-yl)ethyl]hydrazine |
| SMILES | CN1CCOC(C(Cc2nccs2)NN)C1 |
| InChI | InChI=1S/C10H18N4OS/c1-14-3-4-15-9(7-14)8(13-11)6-10-12-2-5-16-10/h2,5,8-9,13H,3-4,6-7,11H2,1H3 |
| InChIKey | KHPKPAKBVYTHSX-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|