C11H19N5S — CID 105250055
[1-(1,4-diazabicyclo[2.2.2]octan-2-yl)-2-(1,3-thiazol-2-yl)ethyl]hydrazine (PubChem CID 105250055) has the molecular formula C11H19N5S and a molecular weight of 253.37 g/mol. Its IUPAC name is [1-(1,4-diazabicyclo[2.2.2]octan-2-yl)-2-(1,3-thiazol-2-yl)ethyl]hydrazine.
| Compound Name | [1-(1,4-diazabicyclo[2.2.2]octan-2-yl)-2-(1,3-thiazol-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105250055 |
| Molecular Formula | C11H19N5S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | [1-(1,4-diazabicyclo[2.2.2]octan-2-yl)-2-(1,3-thiazol-2-yl)ethyl]hydrazine |
| SMILES | NNC(Cc1nccs1)C1CN2CCN1CC2 |
| InChI | InChI=1S/C11H19N5S/c12-14-9(7-11-13-1-6-17-11)10-8-15-2-4-16(10)5-3-15/h1,6,9-10,14H,2-5,7-8,12H2 |
| InChIKey | PBVGBSSCQSOFLL-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 57.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|