C16H26N4 — CID 105249842
[1-(1,4-diazabicyclo[2.2.2]octan-2-yl)-2-(4-ethylphenyl)ethyl]hydrazine (PubChem CID 105249842) has the molecular formula C16H26N4 and a molecular weight of 274.41 g/mol. Its IUPAC name is [1-(1,4-diazabicyclo[2.2.2]octan-2-yl)-2-(4-ethylphenyl)ethyl]hydrazine.
| Compound Name | [1-(1,4-diazabicyclo[2.2.2]octan-2-yl)-2-(4-ethylphenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105249842 |
| Molecular Formula | C16H26N4 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.22 |
| IUPAC Name | [1-(1,4-diazabicyclo[2.2.2]octan-2-yl)-2-(4-ethylphenyl)ethyl]hydrazine |
| SMILES | CCc1ccc(CC(NN)C2CN3CCN2CC3)cc1 |
| InChI | InChI=1S/C16H26N4/c1-2-13-3-5-14(6-4-13)11-15(18-17)16-12-19-7-9-20(16)10-8-19/h3-6,15-16,18H,2,7-12,17H2,1H3 |
| InChIKey | PEGXCIIQPVMNRX-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|