C14H21FN4 — CID 105249872
[1-(1,4-diazabicyclo[2.2.2]octan-2-yl)-2-(4-fluorophenyl)ethyl]hydrazine (PubChem CID 105249872) has the molecular formula C14H21FN4 and a molecular weight of 264.35 g/mol. Its IUPAC name is [1-(1,4-diazabicyclo[2.2.2]octan-2-yl)-2-(4-fluorophenyl)ethyl]hydrazine.
| Compound Name | [1-(1,4-diazabicyclo[2.2.2]octan-2-yl)-2-(4-fluorophenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105249872 |
| Molecular Formula | C14H21FN4 |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | [1-(1,4-diazabicyclo[2.2.2]octan-2-yl)-2-(4-fluorophenyl)ethyl]hydrazine |
| SMILES | NNC(Cc1ccc(F)cc1)C1CN2CCN1CC2 |
| InChI | InChI=1S/C14H21FN4/c15-12-3-1-11(2-4-12)9-13(17-16)14-10-18-5-7-19(14)8-6-18/h1-4,13-14,17H,5-10,16H2 |
| InChIKey | PRZQHLJMIUDHDW-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|