C11H20N4 — CID 105249960
1-(1,4-diazabicyclo[2.2.2]octan-2-yl)pent-4-ynylhydrazine (PubChem CID 105249960) has the molecular formula C11H20N4 and a molecular weight of 208.31 g/mol. Its IUPAC name is 1-(1,4-diazabicyclo[2.2.2]octan-2-yl)pent-4-ynylhydrazine.
| Compound Name | 1-(1,4-diazabicyclo[2.2.2]octan-2-yl)pent-4-ynylhydrazine |
|---|---|
| PubChem CID | 105249960 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | 1-(1,4-diazabicyclo[2.2.2]octan-2-yl)pent-4-ynylhydrazine |
| SMILES | C#CCCC(NN)C1CN2CCN1CC2 |
| InChI | InChI=1S/C11H20N4/c1-2-3-4-10(13-12)11-9-14-5-7-15(11)8-6-14/h1,10-11,13H,3-9,12H2 |
| InChIKey | HPVGKDIARXLRJT-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|