C11H21F3N4 — CID 105249934
[1-(1,4-diazabicyclo[2.2.2]octan-2-yl)-5,5,5-trifluoropentyl]hydrazine (PubChem CID 105249934) has the molecular formula C11H21F3N4 and a molecular weight of 266.31 g/mol. Its IUPAC name is [1-(1,4-diazabicyclo[2.2.2]octan-2-yl)-5,5,5-trifluoropentyl]hydrazine.
| Compound Name | [1-(1,4-diazabicyclo[2.2.2]octan-2-yl)-5,5,5-trifluoropentyl]hydrazine |
|---|---|
| PubChem CID | 105249934 |
| Molecular Formula | C11H21F3N4 |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | [1-(1,4-diazabicyclo[2.2.2]octan-2-yl)-5,5,5-trifluoropentyl]hydrazine |
| SMILES | NNC(CCCC(F)(F)F)C1CN2CCN1CC2 |
| InChI | InChI=1S/C11H21F3N4/c12-11(13,14)3-1-2-9(16-15)10-8-17-4-6-18(10)7-5-17/h9-10,16H,1-8,15H2 |
| InChIKey | UYMVIVNHKROGGI-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|