C10H19F3N2S2 — CID 105259546
[5,5,5-trifluoro-1-(3-methyl-1,4-dithian-2-yl)pentyl]hydrazine (PubChem CID 105259546) has the molecular formula C10H19F3N2S2 and a molecular weight of 288.40 g/mol. Its IUPAC name is [5,5,5-trifluoro-1-(3-methyl-1,4-dithian-2-yl)pentyl]hydrazine.
| Compound Name | [5,5,5-trifluoro-1-(3-methyl-1,4-dithian-2-yl)pentyl]hydrazine |
|---|---|
| PubChem CID | 105259546 |
| Molecular Formula | C10H19F3N2S2 |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | [5,5,5-trifluoro-1-(3-methyl-1,4-dithian-2-yl)pentyl]hydrazine |
| SMILES | CC1SCCSC1C(CCCC(F)(F)F)NN |
| InChI | InChI=1S/C10H19F3N2S2/c1-7-9(17-6-5-16-7)8(15-14)3-2-4-10(11,12)13/h7-9,15H,2-6,14H2,1H3 |
| InChIKey | IWPCNFWAGQUFAU-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.40 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|