C13H28N2S2 — CID 105259521
1-(3-methyl-1,4-dithian-2-yl)octylhydrazine (PubChem CID 105259521) has the molecular formula C13H28N2S2 and a molecular weight of 276.51 g/mol. Its IUPAC name is 1-(3-methyl-1,4-dithian-2-yl)octylhydrazine.
| Compound Name | 1-(3-methyl-1,4-dithian-2-yl)octylhydrazine |
|---|---|
| PubChem CID | 105259521 |
| Molecular Formula | C13H28N2S2 |
| Molecular Weight | 276.51 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 1-(3-methyl-1,4-dithian-2-yl)octylhydrazine |
| SMILES | CCCCCCCC(NN)C1SCCSC1C |
| InChI | InChI=1S/C13H28N2S2/c1-3-4-5-6-7-8-12(15-14)13-11(2)16-9-10-17-13/h11-13,15H,3-10,14H2,1-2H3 |
| InChIKey | DVQIYMTYHIFJMT-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.51 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|