C13H27NS2 — CID 115387051
N-ethyl-1-(3-methyl-1,4-dithian-2-yl)hexan-1-amine (PubChem CID 115387051) has the molecular formula C13H27NS2 and a molecular weight of 261.50 g/mol. Its IUPAC name is N-ethyl-1-(3-methyl-1,4-dithian-2-yl)hexan-1-amine.
| Compound Name | N-ethyl-1-(3-methyl-1,4-dithian-2-yl)hexan-1-amine |
|---|---|
| PubChem CID | 115387051 |
| Molecular Formula | C13H27NS2 |
| Molecular Weight | 261.50 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | N-ethyl-1-(3-methyl-1,4-dithian-2-yl)hexan-1-amine |
| SMILES | CCCCCC(NCC)C1SCCSC1C |
| InChI | InChI=1S/C13H27NS2/c1-4-6-7-8-12(14-5-2)13-11(3)15-9-10-16-13/h11-14H,4-10H2,1-3H3 |
| InChIKey | SROXRZGRTOQJLZ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.50 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|