C16H25NS2 — CID 115387134
N-ethyl-1-(3-methyl-1,4-dithian-2-yl)-3-phenylpropan-1-amine (PubChem CID 115387134) has the molecular formula C16H25NS2 and a molecular weight of 295.52 g/mol. Its IUPAC name is N-ethyl-1-(3-methyl-1,4-dithian-2-yl)-3-phenylpropan-1-amine.
| Compound Name | N-ethyl-1-(3-methyl-1,4-dithian-2-yl)-3-phenylpropan-1-amine |
|---|---|
| PubChem CID | 115387134 |
| Molecular Formula | C16H25NS2 |
| Molecular Weight | 295.52 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | N-ethyl-1-(3-methyl-1,4-dithian-2-yl)-3-phenylpropan-1-amine |
| SMILES | CCNC(CCc1ccccc1)C1SCCSC1C |
| InChI | InChI=1S/C16H25NS2/c1-3-17-15(16-13(2)18-11-12-19-16)10-9-14-7-5-4-6-8-14/h4-8,13,15-17H,3,9-12H2,1-2H3 |
| InChIKey | MCKKFKYZNVEWIO-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.52 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |