C18H29NS2 — CID 115388037
N-ethyl-1-(3-ethyl-1,4-dithian-2-yl)-4-phenylbutan-1-amine (PubChem CID 115388037) has the molecular formula C18H29NS2 and a molecular weight of 323.57 g/mol. Its IUPAC name is N-ethyl-1-(3-ethyl-1,4-dithian-2-yl)-4-phenylbutan-1-amine.
| Compound Name | N-ethyl-1-(3-ethyl-1,4-dithian-2-yl)-4-phenylbutan-1-amine |
|---|---|
| PubChem CID | 115388037 |
| Molecular Formula | C18H29NS2 |
| Molecular Weight | 323.57 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | N-ethyl-1-(3-ethyl-1,4-dithian-2-yl)-4-phenylbutan-1-amine |
| SMILES | CCNC(CCCc1ccccc1)C1SCCSC1CC |
| InChI | InChI=1S/C18H29NS2/c1-3-17-18(21-14-13-20-17)16(19-4-2)12-8-11-15-9-6-5-7-10-15/h5-7,9-10,16-19H,3-4,8,11-14H2,1-2H3 |
| InChIKey | QDWSMEMPVBENKW-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.57 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |