C14H29NOS2 — CID 114856771
1-(3-ethyl-1,4-dithian-2-yl)-4-methoxy-N-propylbutan-1-amine (PubChem CID 114856771) has the molecular formula C14H29NOS2 and a molecular weight of 291.53 g/mol. Its IUPAC name is 1-(3-ethyl-1,4-dithian-2-yl)-4-methoxy-N-propylbutan-1-amine.
| Compound Name | 1-(3-ethyl-1,4-dithian-2-yl)-4-methoxy-N-propylbutan-1-amine |
|---|---|
| PubChem CID | 114856771 |
| Molecular Formula | C14H29NOS2 |
| Molecular Weight | 291.53 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 1-(3-ethyl-1,4-dithian-2-yl)-4-methoxy-N-propylbutan-1-amine |
| SMILES | CCCNC(CCCOC)C1SCCSC1CC |
| InChI | InChI=1S/C14H29NOS2/c1-4-8-15-12(7-6-9-16-3)14-13(5-2)17-10-11-18-14/h12-15H,4-11H2,1-3H3 |
| InChIKey | DCXJHUGDKUJISJ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.53 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|