C15H31NS2 — CID 115387777
1-(3-ethyl-1,4-dithian-2-yl)-N-methyloctan-1-amine (PubChem CID 115387777) has the molecular formula C15H31NS2 and a molecular weight of 289.55 g/mol. Its IUPAC name is 1-(3-ethyl-1,4-dithian-2-yl)-N-methyloctan-1-amine.
| Compound Name | 1-(3-ethyl-1,4-dithian-2-yl)-N-methyloctan-1-amine |
|---|---|
| PubChem CID | 115387777 |
| Molecular Formula | C15H31NS2 |
| Molecular Weight | 289.55 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | 1-(3-ethyl-1,4-dithian-2-yl)-N-methyloctan-1-amine |
| SMILES | CCCCCCCC(NC)C1SCCSC1CC |
| InChI | InChI=1S/C15H31NS2/c1-4-6-7-8-9-10-13(16-3)15-14(5-2)17-11-12-18-15/h13-16H,4-12H2,1-3H3 |
| InChIKey | YVQNPLIHLLUKOT-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.55 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|