C11H19NS2 — CID 115387903
1-(3-ethyl-1,4-dithian-2-yl)-N-methylbut-3-yn-1-amine (PubChem CID 115387903) has the molecular formula C11H19NS2 and a molecular weight of 229.41 g/mol. Its IUPAC name is 1-(3-ethyl-1,4-dithian-2-yl)-N-methylbut-3-yn-1-amine.
| Compound Name | 1-(3-ethyl-1,4-dithian-2-yl)-N-methylbut-3-yn-1-amine |
|---|---|
| PubChem CID | 115387903 |
| Molecular Formula | C11H19NS2 |
| Molecular Weight | 229.41 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 1-(3-ethyl-1,4-dithian-2-yl)-N-methylbut-3-yn-1-amine |
| SMILES | C#CCC(NC)C1SCCSC1CC |
| InChI | InChI=1S/C11H19NS2/c1-4-6-9(12-3)11-10(5-2)13-7-8-14-11/h1,9-12H,5-8H2,2-3H3 |
| InChIKey | AECPQPQCSCBZTF-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.41 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|