C15H22INS2 — CID 115387699
1-(3-ethyl-1,4-dithian-2-yl)-2-(4-iodophenyl)-N-methylethanamine (PubChem CID 115387699) has the molecular formula C15H22INS2 and a molecular weight of 407.39 g/mol. Its IUPAC name is 1-(3-ethyl-1,4-dithian-2-yl)-2-(4-iodophenyl)-N-methylethanamine.
| Compound Name | 1-(3-ethyl-1,4-dithian-2-yl)-2-(4-iodophenyl)-N-methylethanamine |
|---|---|
| PubChem CID | 115387699 |
| Molecular Formula | C15H22INS2 |
| Molecular Weight | 407.39 g/mol |
| Exact Mass | 407.02 |
| IUPAC Name | 1-(3-ethyl-1,4-dithian-2-yl)-2-(4-iodophenyl)-N-methylethanamine |
| SMILES | CCC1SCCSC1C(Cc1ccc(I)cc1)NC |
| InChI | InChI=1S/C15H22INS2/c1-3-14-15(19-9-8-18-14)13(17-2)10-11-4-6-12(16)7-5-11/h4-7,13-15,17H,3,8-10H2,1-2H3 |
| InChIKey | FFLYHOPASSXOMF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.39 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|