C19H28IN — CID 115864263
1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-(4-iodophenyl)-N-methylethanamine (PubChem CID 115864263) has the molecular formula C19H28IN and a molecular weight of 397.34 g/mol. Its IUPAC name is 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-(4-iodophenyl)-N-methylethanamine.
| Compound Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-(4-iodophenyl)-N-methylethanamine |
|---|---|
| PubChem CID | 115864263 |
| Molecular Formula | C19H28IN |
| Molecular Weight | 397.34 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-(4-iodophenyl)-N-methylethanamine |
| SMILES | CNC(Cc1ccc(I)cc1)C1CCC2CCCCC2C1 |
| InChI | InChI=1S/C19H28IN/c1-21-19(12-14-6-10-18(20)11-7-14)17-9-8-15-4-2-3-5-16(15)13-17/h6-7,10-11,15-17,19,21H,2-5,8-9,12-13H2,1H3 |
| InChIKey | RESNWLQBUOCDAB-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.34 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|