C10H17NS2 — CID 115387674
1-(3-ethyl-1,4-dithian-2-yl)but-3-yn-1-amine (PubChem CID 115387674) has the molecular formula C10H17NS2 and a molecular weight of 215.39 g/mol. Its IUPAC name is 1-(3-ethyl-1,4-dithian-2-yl)but-3-yn-1-amine.
| Compound Name | 1-(3-ethyl-1,4-dithian-2-yl)but-3-yn-1-amine |
|---|---|
| PubChem CID | 115387674 |
| Molecular Formula | C10H17NS2 |
| Molecular Weight | 215.39 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 1-(3-ethyl-1,4-dithian-2-yl)but-3-yn-1-amine |
| SMILES | C#CCC(N)C1SCCSC1CC |
| InChI | InChI=1S/C10H17NS2/c1-3-5-8(11)10-9(4-2)12-6-7-13-10/h1,8-10H,4-7,11H2,2H3 |
| InChIKey | MDACTDVRQKXZNA-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.39 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|