C14H21NOS2 — CID 115387483
3-[2-amino-2-(3-ethyl-1,4-dithian-2-yl)ethyl]phenol (PubChem CID 115387483) has the molecular formula C14H21NOS2 and a molecular weight of 283.46 g/mol. Its IUPAC name is 3-[2-amino-2-(3-ethyl-1,4-dithian-2-yl)ethyl]phenol.
| Compound Name | 3-[2-amino-2-(3-ethyl-1,4-dithian-2-yl)ethyl]phenol |
|---|---|
| PubChem CID | 115387483 |
| Molecular Formula | C14H21NOS2 |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 3-[2-amino-2-(3-ethyl-1,4-dithian-2-yl)ethyl]phenol |
| SMILES | CCC1SCCSC1C(N)Cc1cccc(O)c1 |
| InChI | InChI=1S/C14H21NOS2/c1-2-13-14(18-7-6-17-13)12(15)9-10-4-3-5-11(16)8-10/h3-5,8,12-14,16H,2,6-7,9,15H2,1H3 |
| InChIKey | CEXQHNDSLWICGO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |