C16H26N2S2 — CID 105259775
[1-(3-ethyl-1,4-dithian-2-yl)-4-phenylbutyl]hydrazine (PubChem CID 105259775) has the molecular formula C16H26N2S2 and a molecular weight of 310.53 g/mol. Its IUPAC name is [1-(3-ethyl-1,4-dithian-2-yl)-4-phenylbutyl]hydrazine.
| Compound Name | [1-(3-ethyl-1,4-dithian-2-yl)-4-phenylbutyl]hydrazine |
|---|---|
| PubChem CID | 105259775 |
| Molecular Formula | C16H26N2S2 |
| Molecular Weight | 310.53 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | [1-(3-ethyl-1,4-dithian-2-yl)-4-phenylbutyl]hydrazine |
| SMILES | CCC1SCCSC1C(CCCc1ccccc1)NN |
| InChI | InChI=1S/C16H26N2S2/c1-2-15-16(20-12-11-19-15)14(18-17)10-6-9-13-7-4-3-5-8-13/h3-5,7-8,14-16,18H,2,6,9-12,17H2,1H3 |
| InChIKey | JGMFXUNZOGLFGL-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.53 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|