About [1-(3-ethyl-1,4-dithian-2-yl)-2-(oxan-4-yl)ethyl]hydrazine
[1-(3-ethyl-1,4-dithian-2-yl)-2-(oxan-4-yl)ethyl]hydrazine (PubChem CID 105259825) has the molecular formula C13H26N2OS2
and a molecular weight of 290.50 g/mol. Its IUPAC name is [1-(3-ethyl-1,4-dithian-2-yl)-2-(oxan-4-yl)ethyl]hydrazine.
Molecular Properties
| Compound Name | [1-(3-ethyl-1,4-dithian-2-yl)-2-(oxan-4-yl)ethyl]hydrazine |
| PubChem CID | 105259825 |
| Molecular Formula | C13H26N2OS2 |
| Molecular Weight | 290.50 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | [1-(3-ethyl-1,4-dithian-2-yl)-2-(oxan-4-yl)ethyl]hydrazine |
| SMILES | CCC1SCCSC1C(CC1CCOCC1)NN |
| InChI | InChI=1S/C13H26N2OS2/c1-2-12-13(18-8-7-17-12)11(15-14)9-10-3-5-16-6-4-10/h10-13,15H,2-9,14H2,1H3 |
| InChIKey | NYFZAMFFOMBJQV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.50 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [1-(3-ethyl-1,4-dithian-2-yl)-2-(oxan-4-yl)ethyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(3-ethyl-1,4-dithian-2-yl)-2-(oxan-4-yl)ethyl]hydrazine?
The IUPAC name of [1-(3-ethyl-1,4-dithian-2-yl)-2-(oxan-4-yl)ethyl]hydrazine (CID 105259825) is [1-(3-ethyl-1,4-dithian-2-yl)-2-(oxan-4-yl)ethyl]hydrazine.
What is the SMILES notation for [1-(3-ethyl-1,4-dithian-2-yl)-2-(oxan-4-yl)ethyl]hydrazine?
The canonical SMILES for [1-(3-ethyl-1,4-dithian-2-yl)-2-(oxan-4-yl)ethyl]hydrazine is CCC1SCCSC1C(CC1CCOCC1)NN.
What is the InChIKey of [1-(3-ethyl-1,4-dithian-2-yl)-2-(oxan-4-yl)ethyl]hydrazine?
The InChIKey is NYFZAMFFOMBJQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2OS2/c1-2-12-13(18-8-7-17-12)11(15-14)9-10-3-5-16-6-4-10/h10-13,15H,2-9,14H2,1H3.
What are the key properties of [1-(3-ethyl-1,4-dithian-2-yl)-2-(oxan-4-yl)ethyl]hydrazine?
[1-(3-ethyl-1,4-dithian-2-yl)-2-(oxan-4-yl)ethyl]hydrazine has a molecular weight of 290.50 g/mol, XLogP of 2.26, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(3-ethyl-1,4-dithian-2-yl)-2-(oxan-4-yl)ethyl]hydrazine is sourced from PubChem (CID 105259825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).