C13H26N2OS2 — CID 105259825
[1-(3-ethyl-1,4-dithian-2-yl)-2-(oxan-4-yl)ethyl]hydrazine (PubChem CID 105259825) has the molecular formula C13H26N2OS2 and a molecular weight of 290.50 g/mol. Its IUPAC name is [1-(3-ethyl-1,4-dithian-2-yl)-2-(oxan-4-yl)ethyl]hydrazine.
| Compound Name | [1-(3-ethyl-1,4-dithian-2-yl)-2-(oxan-4-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105259825 |
| Molecular Formula | C13H26N2OS2 |
| Molecular Weight | 290.50 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | [1-(3-ethyl-1,4-dithian-2-yl)-2-(oxan-4-yl)ethyl]hydrazine |
| SMILES | CCC1SCCSC1C(CC1CCOCC1)NN |
| InChI | InChI=1S/C13H26N2OS2/c1-2-12-13(18-8-7-17-12)11(15-14)9-10-3-5-16-6-4-10/h10-13,15H,2-9,14H2,1H3 |
| InChIKey | NYFZAMFFOMBJQV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.50 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|