C12H21N3S3 — CID 105259904
[1-(3-ethyl-1,4-dithian-2-yl)-2-(4-methyl-1,3-thiazol-2-yl)ethyl]hydrazine (PubChem CID 105259904) has the molecular formula C12H21N3S3 and a molecular weight of 303.52 g/mol. Its IUPAC name is [1-(3-ethyl-1,4-dithian-2-yl)-2-(4-methyl-1,3-thiazol-2-yl)ethyl]hydrazine.
| Compound Name | [1-(3-ethyl-1,4-dithian-2-yl)-2-(4-methyl-1,3-thiazol-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105259904 |
| Molecular Formula | C12H21N3S3 |
| Molecular Weight | 303.52 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | [1-(3-ethyl-1,4-dithian-2-yl)-2-(4-methyl-1,3-thiazol-2-yl)ethyl]hydrazine |
| SMILES | CCC1SCCSC1C(Cc1nc(C)cs1)NN |
| InChI | InChI=1S/C12H21N3S3/c1-3-10-12(17-5-4-16-10)9(15-13)6-11-14-8(2)7-18-11/h7,9-10,12,15H,3-6,13H2,1-2H3 |
| InChIKey | LAVVMWXYASKOKD-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.52 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|