C10H22N2O2S3 — CID 114984877
[1-(3-ethyl-1,4-dithian-2-yl)-3-methylsulfonylpropyl]hydrazine (PubChem CID 114984877) has the molecular formula C10H22N2O2S3 and a molecular weight of 298.50 g/mol. Its IUPAC name is [1-(3-ethyl-1,4-dithian-2-yl)-3-methylsulfonylpropyl]hydrazine.
| Compound Name | [1-(3-ethyl-1,4-dithian-2-yl)-3-methylsulfonylpropyl]hydrazine |
|---|---|
| PubChem CID | 114984877 |
| Molecular Formula | C10H22N2O2S3 |
| Molecular Weight | 298.50 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | [1-(3-ethyl-1,4-dithian-2-yl)-3-methylsulfonylpropyl]hydrazine |
| SMILES | CCC1SCCSC1C(CCS(C)(=O)=O)NN |
| InChI | InChI=1S/C10H22N2O2S3/c1-3-9-10(16-6-5-15-9)8(12-11)4-7-17(2,13)14/h8-10,12H,3-7,11H2,1-2H3 |
| InChIKey | NQHYWHOWDHKCOF-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.50 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|