C11H21NS2 — CID 115387594
2-cyclopropyl-1-(3-ethyl-1,4-dithian-2-yl)ethanamine (PubChem CID 115387594) has the molecular formula C11H21NS2 and a molecular weight of 231.43 g/mol. Its IUPAC name is 2-cyclopropyl-1-(3-ethyl-1,4-dithian-2-yl)ethanamine.
| Compound Name | 2-cyclopropyl-1-(3-ethyl-1,4-dithian-2-yl)ethanamine |
|---|---|
| PubChem CID | 115387594 |
| Molecular Formula | C11H21NS2 |
| Molecular Weight | 231.43 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 2-cyclopropyl-1-(3-ethyl-1,4-dithian-2-yl)ethanamine |
| SMILES | CCC1SCCSC1C(N)CC1CC1 |
| InChI | InChI=1S/C11H21NS2/c1-2-10-11(14-6-5-13-10)9(12)7-8-3-4-8/h8-11H,2-7,12H2,1H3 |
| InChIKey | PRFMJEZPZVMWRO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.43 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |