C15H28OS2 — CID 113299467
(3-ethylcyclohexyl)-(3-ethyl-1,4-dithian-2-yl)methanol (PubChem CID 113299467) has the molecular formula C15H28OS2 and a molecular weight of 288.52 g/mol. Its IUPAC name is (3-ethylcyclohexyl)-(3-ethyl-1,4-dithian-2-yl)methanol.
| Compound Name | (3-ethylcyclohexyl)-(3-ethyl-1,4-dithian-2-yl)methanol |
|---|---|
| PubChem CID | 113299467 |
| Molecular Formula | C15H28OS2 |
| Molecular Weight | 288.52 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | (3-ethylcyclohexyl)-(3-ethyl-1,4-dithian-2-yl)methanol |
| SMILES | CCC1CCCC(C(O)C2SCCSC2CC)C1 |
| InChI | InChI=1S/C15H28OS2/c1-3-11-6-5-7-12(10-11)14(16)15-13(4-2)17-8-9-18-15/h11-16H,3-10H2,1-2H3 |
| InChIKey | STZOXQJSGUILSL-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.52 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |