C10H18F2O — CID 112699179
1-(3-ethylcyclohexyl)-2,2-difluoroethanol (PubChem CID 112699179) has the molecular formula C10H18F2O and a molecular weight of 192.25 g/mol. Its IUPAC name is 1-(3-ethylcyclohexyl)-2,2-difluoroethanol.
| Compound Name | 1-(3-ethylcyclohexyl)-2,2-difluoroethanol |
|---|---|
| PubChem CID | 112699179 |
| Molecular Formula | C10H18F2O |
| Molecular Weight | 192.25 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 1-(3-ethylcyclohexyl)-2,2-difluoroethanol |
| SMILES | CCC1CCCC(C(O)C(F)F)C1 |
| InChI | InChI=1S/C10H18F2O/c1-2-7-4-3-5-8(6-7)9(13)10(11)12/h7-10,13H,2-6H2,1H3 |
| InChIKey | QSXMAWQWQIKMMY-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.25 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |