C10H17ClF2O — CID 112575163
2-chloro-1-(3-ethylcyclohexyl)-2,2-difluoroethanol (PubChem CID 112575163) has the molecular formula C10H17ClF2O and a molecular weight of 226.69 g/mol. Its IUPAC name is 2-chloro-1-(3-ethylcyclohexyl)-2,2-difluoroethanol.
| Compound Name | 2-chloro-1-(3-ethylcyclohexyl)-2,2-difluoroethanol |
|---|---|
| PubChem CID | 112575163 |
| Molecular Formula | C10H17ClF2O |
| Molecular Weight | 226.69 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 2-chloro-1-(3-ethylcyclohexyl)-2,2-difluoroethanol |
| SMILES | CCC1CCCC(C(O)C(F)(F)Cl)C1 |
| InChI | InChI=1S/C10H17ClF2O/c1-2-7-4-3-5-8(6-7)9(14)10(11,12)13/h7-9,14H,2-6H2,1H3 |
| InChIKey | JCFXTDPLIQPSKI-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.69 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|