C14H27NS2 — CID 82931537
cycloheptyl-(3-ethyl-1,4-dithian-2-yl)methanamine (PubChem CID 82931537) has the molecular formula C14H27NS2 and a molecular weight of 273.51 g/mol. Its IUPAC name is cycloheptyl-(3-ethyl-1,4-dithian-2-yl)methanamine.
| Compound Name | cycloheptyl-(3-ethyl-1,4-dithian-2-yl)methanamine |
|---|---|
| PubChem CID | 82931537 |
| Molecular Formula | C14H27NS2 |
| Molecular Weight | 273.51 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | cycloheptyl-(3-ethyl-1,4-dithian-2-yl)methanamine |
| SMILES | CCC1SCCSC1C(N)C1CCCCCC1 |
| InChI | InChI=1S/C14H27NS2/c1-2-12-14(17-10-9-16-12)13(15)11-7-5-3-4-6-8-11/h11-14H,2-10,15H2,1H3 |
| InChIKey | VBOPVZIRQFFSHC-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |