C15H29NS2 — CID 113299690
(4-ethylcyclohexyl)-(3-ethyl-1,4-dithian-2-yl)methanamine (PubChem CID 113299690) has the molecular formula C15H29NS2 and a molecular weight of 287.54 g/mol. Its IUPAC name is (4-ethylcyclohexyl)-(3-ethyl-1,4-dithian-2-yl)methanamine.
| Compound Name | (4-ethylcyclohexyl)-(3-ethyl-1,4-dithian-2-yl)methanamine |
|---|---|
| PubChem CID | 113299690 |
| Molecular Formula | C15H29NS2 |
| Molecular Weight | 287.54 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | (4-ethylcyclohexyl)-(3-ethyl-1,4-dithian-2-yl)methanamine |
| SMILES | CCC1CCC(C(N)C2SCCSC2CC)CC1 |
| InChI | InChI=1S/C15H29NS2/c1-3-11-5-7-12(8-6-11)14(16)15-13(4-2)17-9-10-18-15/h11-15H,3-10,16H2,1-2H3 |
| InChIKey | CQVXYVFUUYTRKH-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.54 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |