C12H21F2NS2 — CID 114224884
2-(3,3-difluorocyclohexyl)-1-(1,4-dithian-2-yl)ethanamine (PubChem CID 114224884) has the molecular formula C12H21F2NS2 and a molecular weight of 281.44 g/mol. Its IUPAC name is 2-(3,3-difluorocyclohexyl)-1-(1,4-dithian-2-yl)ethanamine.
| Compound Name | 2-(3,3-difluorocyclohexyl)-1-(1,4-dithian-2-yl)ethanamine |
|---|---|
| PubChem CID | 114224884 |
| Molecular Formula | C12H21F2NS2 |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 2-(3,3-difluorocyclohexyl)-1-(1,4-dithian-2-yl)ethanamine |
| SMILES | NC(CC1CCCC(F)(F)C1)C1CSCCS1 |
| InChI | InChI=1S/C12H21F2NS2/c13-12(14)3-1-2-9(7-12)6-10(15)11-8-16-4-5-17-11/h9-11H,1-8,15H2 |
| InChIKey | FZGVGKQYDAIEDQ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |