C10H18F3NS2 — CID 123307024
4-[4-(disulfanyl)cyclohexyl]-1,1,1-trifluorobutan-2-amine (PubChem CID 123307024) has the molecular formula C10H18F3NS2 and a molecular weight of 273.39 g/mol. Its IUPAC name is 4-[4-(disulfanyl)cyclohexyl]-1,1,1-trifluorobutan-2-amine.
| Compound Name | 4-[4-(disulfanyl)cyclohexyl]-1,1,1-trifluorobutan-2-amine |
|---|---|
| PubChem CID | 123307024 |
| Molecular Formula | C10H18F3NS2 |
| Molecular Weight | 273.39 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 4-[4-(disulfanyl)cyclohexyl]-1,1,1-trifluorobutan-2-amine |
| SMILES | NC(CCC1CCC(SS)CC1)C(F)(F)F |
| InChI | InChI=1S/C10H18F3NS2/c11-10(12,13)9(14)6-3-7-1-4-8(16-15)5-2-7/h7-9,15H,1-6,14H2 |
| InChIKey | HVRKEECFBWTZSC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.39 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|