About 1-cyclopropyl-4,5-dimethylhexan-3-amine
1-cyclopropyl-4,5-dimethylhexan-3-amine (PubChem CID 104995209) has the molecular formula C11H23N
and a molecular weight of 169.31 g/mol. Its IUPAC name is 1-cyclopropyl-4,5-dimethylhexan-3-amine.
Molecular Properties
| Compound Name | 1-cyclopropyl-4,5-dimethylhexan-3-amine |
| PubChem CID | 104995209 |
| Molecular Formula | C11H23N |
| Molecular Weight | 169.31 g/mol |
| Exact Mass | 169.18 |
| IUPAC Name | 1-cyclopropyl-4,5-dimethylhexan-3-amine |
| SMILES | CC(C)C(C)C(N)CCC1CC1 |
| InChI | InChI=1S/C11H23N/c1-8(2)9(3)11(12)7-6-10-4-5-10/h8-11H,4-7,12H2,1-3H3 |
| InChIKey | VNPWDHAGQFLFTM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.31 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclopropyl-4,5-dimethylhexan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-4,5-dimethylhexan-3-amine?
The IUPAC name of 1-cyclopropyl-4,5-dimethylhexan-3-amine (CID 104995209) is 1-cyclopropyl-4,5-dimethylhexan-3-amine.
What is the SMILES notation for 1-cyclopropyl-4,5-dimethylhexan-3-amine?
The canonical SMILES for 1-cyclopropyl-4,5-dimethylhexan-3-amine is CC(C)C(C)C(N)CCC1CC1.
What is the InChIKey of 1-cyclopropyl-4,5-dimethylhexan-3-amine?
The InChIKey is VNPWDHAGQFLFTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N/c1-8(2)9(3)11(12)7-6-10-4-5-10/h8-11H,4-7,12H2,1-3H3.
What are the key properties of 1-cyclopropyl-4,5-dimethylhexan-3-amine?
1-cyclopropyl-4,5-dimethylhexan-3-amine has a molecular weight of 169.31 g/mol, XLogP of 2.80, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-4,5-dimethylhexan-3-amine is sourced from PubChem (CID 104995209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).