C5H7F6N — CID 171203128
(2R)-1,1,1,5,5,5-hexafluoropentan-2-amine (PubChem CID 171203128) has the molecular formula C5H7F6N and a molecular weight of 195.11 g/mol. Its IUPAC name is (2R)-1,1,1,5,5,5-hexafluoropentan-2-amine.
| Compound Name | (2R)-1,1,1,5,5,5-hexafluoropentan-2-amine |
|---|---|
| PubChem CID | 171203128 |
| Molecular Formula | C5H7F6N |
| Molecular Weight | 195.11 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | (2R)-1,1,1,5,5,5-hexafluoropentan-2-amine |
| SMILES | N[C@H](CCC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5H7F6N/c6-4(7,8)2-1-3(12)5(9,10)11/h3H,1-2,12H2/t3-/m1/s1 |
| InChIKey | WRRDCKHMWZWDPQ-GSVOUGTGSA-N |
| XLogP | 2.22 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.11 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |