C6H14ClF3N2 — CID 171203123
(5R)-6,6,6-trifluorohexane-1,5-diamine;hydrochloride (PubChem CID 171203123) has the molecular formula C6H14ClF3N2 and a molecular weight of 206.64 g/mol. Its IUPAC name is (5R)-6,6,6-trifluorohexane-1,5-diamine;hydrochloride.
| Compound Name | (5R)-6,6,6-trifluorohexane-1,5-diamine;hydrochloride |
|---|---|
| PubChem CID | 171203123 |
| Molecular Formula | C6H14ClF3N2 |
| Molecular Weight | 206.64 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | (5R)-6,6,6-trifluorohexane-1,5-diamine;hydrochloride |
| SMILES | Cl.NCCCC[C@@H](N)C(F)(F)F |
| InChI | InChI=1S/C6H13F3N2.ClH/c7-6(8,9)5(11)3-1-2-4-10;/h5H,1-4,10-11H2;1H/t5-;/m1./s1 |
| InChIKey | ADEDGHFAVYHNEK-NUBCRITNSA-N |
| XLogP | 1.43 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.64 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|