C8H13F7N2 — CID 171210339
(5R)-6,6,7,7,8,8,8-heptafluorooctane-1,5-diamine (PubChem CID 171210339) has the molecular formula C8H13F7N2 and a molecular weight of 270.19 g/mol. Its IUPAC name is (5R)-6,6,7,7,8,8,8-heptafluorooctane-1,5-diamine.
| Compound Name | (5R)-6,6,7,7,8,8,8-heptafluorooctane-1,5-diamine |
|---|---|
| PubChem CID | 171210339 |
| Molecular Formula | C8H13F7N2 |
| Molecular Weight | 270.19 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | (5R)-6,6,7,7,8,8,8-heptafluorooctane-1,5-diamine |
| SMILES | NCCCC[C@@H](N)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H13F7N2/c9-6(10,5(17)3-1-2-4-16)7(11,12)8(13,14)15/h5H,1-4,16-17H2/t5-/m1/s1 |
| InChIKey | DESXZJPHTUCQAF-RXMQYKEDSA-N |
| XLogP | 2.28 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.19 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|